C8H14N2 — CID 54451012
1-N,2-N-dimethylcyclohexa-2,6-diene-1,2-diamine (PubChem CID 54451012) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-N,2-N-dimethylcyclohexa-2,6-diene-1,2-diamine.
| Compound Name | 1-N,2-N-dimethylcyclohexa-2,6-diene-1,2-diamine |
|---|---|
| PubChem CID | 54451012 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1-N,2-N-dimethylcyclohexa-2,6-diene-1,2-diamine |
| SMILES | CNC1=CCCC=C1NC |
| InChI | InChI=1S/C8H14N2/c1-9-7-5-3-4-6-8(7)10-2/h5-6,9-10H,3-4H2,1-2H3 |
| InChIKey | WUYYIPSUGWTIQG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |