C40H51F3N2O4 — CID 54451018
[(2R)-1,1,1-trifluorooctan-2-yl] 6-[4-(5-decylpyrimidin-2-yl)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 54451018) has the molecular formula C40H51F3N2O4 and a molecular weight of 680.85 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorooctan-2-yl] 6-[4-(5-decylpyrimidin-2-yl)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [(2R)-1,1,1-trifluorooctan-2-yl] 6-[4-(5-decylpyrimidin-2-yl)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54451018 |
| Molecular Formula | C40H51F3N2O4 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.38 |
| IUPAC Name | [(2R)-1,1,1-trifluorooctan-2-yl] 6-[4-(5-decylpyrimidin-2-yl)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(C(=O)Oc3ccc4c(c3)CCC(C(=O)O[C@H](CCCCCC)C(F)(F)F)C4)cc2)nc1 |
| InChI | InChI=1S/C40H51F3N2O4/c1-3-5-7-9-10-11-12-13-15-29-27-44-37(45-28-29)30-17-19-31(20-18-30)38(46)48-35-24-23-32-25-34(22-21-33(32)26-35)39(47)49-36(40(41,42)43)16-14-8-6-4-2/h17-20,23-24,26-28,34,36H,3-16,21-22,25H2,1-2H3/t34?,36-/m1/s1 |
| InChIKey | WUZCRWRZWMXNCX-RFSJIHGVSA-N |
| XLogP | 10.60 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|