C24H37NO2 — CID 54451837
N-(2-hydroxyethyl)docosa-2,4,6,8,10,12-hexaenamide (PubChem CID 54451837) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is N-(2-hydroxyethyl)docosa-2,4,6,8,10,12-hexaenamide.
| Compound Name | N-(2-hydroxyethyl)docosa-2,4,6,8,10,12-hexaenamide |
|---|---|
| PubChem CID | 54451837 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | N-(2-hydroxyethyl)docosa-2,4,6,8,10,12-hexaenamide |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)NCCO |
| InChI | InChI=1S/C24H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(27)25-22-23-26/h10-21,26H,2-9,22-23H2,1H3,(H,25,27) |
| InChIKey | WVMKYAHQZYCCCX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|