C18H22O4S — CID 54452187
(3-hydroxyphenyl) 2,3-dipropylbenzenesulfonate (PubChem CID 54452187) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is (3-hydroxyphenyl) 2,3-dipropylbenzenesulfonate.
| Compound Name | (3-hydroxyphenyl) 2,3-dipropylbenzenesulfonate |
|---|---|
| PubChem CID | 54452187 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (3-hydroxyphenyl) 2,3-dipropylbenzenesulfonate |
| SMILES | CCCc1cccc(S(=O)(=O)Oc2cccc(O)c2)c1CCC |
| InChI | InChI=1S/C18H22O4S/c1-3-7-14-9-5-12-18(17(14)8-4-2)23(20,21)22-16-11-6-10-15(19)13-16/h5-6,9-13,19H,3-4,7-8H2,1-2H3 |
| InChIKey | WVRRBGDOMPGJGU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|