About trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium
trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium (PubChem CID 54453513) has the molecular formula C7H14N3O+
and a molecular weight of 156.21 g/mol. Its IUPAC name is trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium.
Molecular Properties
| Compound Name | trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium |
| PubChem CID | 54453513 |
| Molecular Formula | C7H14N3O+ |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium |
| SMILES | C[N+](C)(C)Cc1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H13N3O/c1-10(2,3)5-6-4-8-7(11)9-6/h4H,5H2,1-3H3,(H-,8,9,11)/p+1 |
| InChIKey | WWOQDTTVEWHZEP-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium?
The IUPAC name of trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium (CID 54453513) is trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium.
What is the SMILES notation for trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium?
The canonical SMILES for trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium is C[N+](C)(C)Cc1c[nH]c(=O)[nH]1.
What is the InChIKey of trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium?
The InChIKey is WWOQDTTVEWHZEP-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H13N3O/c1-10(2,3)5-6-4-8-7(11)9-6/h4H,5H2,1-3H3,(H-,8,9,11)/p+1.
What are the key properties of trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium?
trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium has a molecular weight of 156.21 g/mol, XLogP of -0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(2-oxo-1,3-dihydroimidazol-4-yl)methyl]azanium is sourced from PubChem (CID 54453513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).