About 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid
2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid (PubChem CID 54453629) has the molecular formula C18H19Cl3O3
and a molecular weight of 389.71 g/mol. Its IUPAC name is 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid |
| PubChem CID | 54453629 |
| Molecular Formula | C18H19Cl3O3 |
| Molecular Weight | 389.71 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid |
| SMILES | CCCC1(CC=C(C)Cl)Cc2cc(CC(=O)O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C18H19Cl3O3/c1-3-5-18(6-4-10(2)19)9-12-7-11(8-13(22)23)15(20)16(21)14(12)17(18)24/h4,7H,3,5-6,8-9H2,1-2H3,(H,22,23) |
| InChIKey | WWQVLBWOZMYXKD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.71 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid?
The IUPAC name of 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid (CID 54453629) is 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid.
What is the SMILES notation for 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid?
The canonical SMILES for 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid is CCCC1(CC=C(C)Cl)Cc2cc(CC(=O)O)c(Cl)c(Cl)c2C1=O.
What is the InChIKey of 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid?
The InChIKey is WWQVLBWOZMYXKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Cl3O3/c1-3-5-18(6-4-10(2)19)9-12-7-11(8-13(22)23)15(20)16(21)14(12)17(18)24/h4,7H,3,5-6,8-9H2,1-2H3,(H,22,23).
What are the key properties of 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid?
2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid has a molecular weight of 389.71 g/mol, XLogP of 5.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6,7-dichloro-2-(3-chlorobut-2-enyl)-1-oxo-2-propyl-3H-inden-5-yl]acetic acid is sourced from PubChem (CID 54453629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).