C10H20N2O — CID 54453682
3-[(1R)-1-(ethylamino)ethyl]-1,5-dimethylpyrrolidin-2-one (PubChem CID 54453682) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-[(1R)-1-(ethylamino)ethyl]-1,5-dimethylpyrrolidin-2-one.
| Compound Name | 3-[(1R)-1-(ethylamino)ethyl]-1,5-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 54453682 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-[(1R)-1-(ethylamino)ethyl]-1,5-dimethylpyrrolidin-2-one |
| SMILES | CCN[C@H](C)C1CC(C)N(C)C1=O |
| InChI | InChI=1S/C10H20N2O/c1-5-11-8(3)9-6-7(2)12(4)10(9)13/h7-9,11H,5-6H2,1-4H3/t7?,8-,9?/m1/s1 |
| InChIKey | WWRRANCIRWYAEI-QJAFJHJLSA-N |
| XLogP | 0.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |