C11H17F3O3 — CID 54453795
methyl (2R,3R)-6,6,6-trifluoro-3-hydroxy-2-(2-methylprop-2-enyl)hexanoate (PubChem CID 54453795) has the molecular formula C11H17F3O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is methyl (2R,3R)-6,6,6-trifluoro-3-hydroxy-2-(2-methylprop-2-enyl)hexanoate.
| Compound Name | methyl (2R,3R)-6,6,6-trifluoro-3-hydroxy-2-(2-methylprop-2-enyl)hexanoate |
|---|---|
| PubChem CID | 54453795 |
| Molecular Formula | C11H17F3O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | methyl (2R,3R)-6,6,6-trifluoro-3-hydroxy-2-(2-methylprop-2-enyl)hexanoate |
| SMILES | C=C(C)CC(C(=O)OC)[C@H](O)CCC(F)(F)F |
| InChI | InChI=1S/C11H17F3O3/c1-7(2)6-8(10(16)17-3)9(15)4-5-11(12,13)14/h8-9,15H,1,4-6H2,2-3H3/t8?,9-/m1/s1 |
| InChIKey | WWTUIENLMFRFKP-YGPZHTELSA-N |
| XLogP | 2.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|