C9H16 — CID 54453887
(4Z)-2,3,4-trimethylhexa-2,4-diene (PubChem CID 54453887) has the molecular formula C9H16 and a molecular weight of 124.22 g/mol. Its IUPAC name is (4Z)-2,3,4-trimethylhexa-2,4-diene.
| Compound Name | (4Z)-2,3,4-trimethylhexa-2,4-diene |
|---|---|
| PubChem CID | 54453887 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.22 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (4Z)-2,3,4-trimethylhexa-2,4-diene |
| SMILES | C/C=C(/C)\C(=C(C)C)C |
| InChI | InChI=1S/C9H16/c1-6-8(4)9(5)7(2)3/h6H,1-5H3/b8-6- |
| InChIKey | WWVDCCOPIOUFOU-VURMDHGXSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | 143 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|