C22H22O8 — CID 54454407
[3-[2-(3-acetyloxy-5,5-dimethyl-4,6-dioxocyclohex-2-en-1-ylidene)ethylidene]-5,5-dimethyl-4,6-dioxocyclohexen-1-yl] acetate (PubChem CID 54454407) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is [3-[2-(3-acetyloxy-5,5-dimethyl-4,6-dioxocyclohex-2-en-1-ylidene)ethylidene]-5,5-dimethyl-4,6-dioxocyclohexen-1-yl] acetate.
| Compound Name | [3-[2-(3-acetyloxy-5,5-dimethyl-4,6-dioxocyclohex-2-en-1-ylidene)ethylidene]-5,5-dimethyl-4,6-dioxocyclohexen-1-yl] acetate |
|---|---|
| PubChem CID | 54454407 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [3-[2-(3-acetyloxy-5,5-dimethyl-4,6-dioxocyclohex-2-en-1-ylidene)ethylidene]-5,5-dimethyl-4,6-dioxocyclohexen-1-yl] acetate |
| SMILES | CC(=O)OC1=CC(=CC=C2C=C(OC(C)=O)C(=O)C(C)(C)C2=O)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C22H22O8/c1-11(23)29-15-9-13(17(25)21(3,4)19(15)27)7-8-14-10-16(30-12(2)24)20(28)22(5,6)18(14)26/h7-10H,1-6H3 |
| InChIKey | WXDWHYQMTVTICG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|