About N,N-dimethylmethanamine;methylsulfanylmethane
N,N-dimethylmethanamine;methylsulfanylmethane (PubChem CID 54454543) has the molecular formula C5H15NS
and a molecular weight of 121.25 g/mol. Its IUPAC name is N,N-dimethylmethanamine;methylsulfanylmethane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;methylsulfanylmethane |
| PubChem CID | 54454543 |
| Molecular Formula | C5H15NS |
| Molecular Weight | 121.25 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | N,N-dimethylmethanamine;methylsulfanylmethane |
| SMILES | CN(C)C.CSC |
| InChI | InChI=1S/C3H9N.C2H6S/c1-4(2)3;1-3-2/h1-3H3;1-2H3 |
| InChIKey | WXGBUUMROJZDIS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylmethanamine;methylsulfanylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;methylsulfanylmethane?
The IUPAC name of N,N-dimethylmethanamine;methylsulfanylmethane (CID 54454543) is N,N-dimethylmethanamine;methylsulfanylmethane.
What is the SMILES notation for N,N-dimethylmethanamine;methylsulfanylmethane?
The canonical SMILES for N,N-dimethylmethanamine;methylsulfanylmethane is CN(C)C.CSC.
What is the InChIKey of N,N-dimethylmethanamine;methylsulfanylmethane?
The InChIKey is WXGBUUMROJZDIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H6S/c1-4(2)3;1-3-2/h1-3H3;1-2H3.
What are the key properties of N,N-dimethylmethanamine;methylsulfanylmethane?
N,N-dimethylmethanamine;methylsulfanylmethane has a molecular weight of 121.25 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;methylsulfanylmethane is sourced from PubChem (CID 54454543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).