About [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate
[[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate (PubChem CID 54454802) has the molecular formula C15H10Cl2N2O3S
and a molecular weight of 369.23 g/mol. Its IUPAC name is [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate.
Molecular Properties
| Compound Name | [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate |
| PubChem CID | 54454802 |
| Molecular Formula | C15H10Cl2N2O3S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate |
| SMILES | CS(=O)(=O)ON=C1C=C(Cl)C(=C(C#N)c2ccccc2)C=C1Cl |
| InChI | InChI=1S/C15H10Cl2N2O3S/c1-23(20,21)22-19-15-8-13(16)11(7-14(15)17)12(9-18)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | WXKXSVZTDJDLSK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate?
The IUPAC name of [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate (CID 54454802) is [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate.
What is the SMILES notation for [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate?
The canonical SMILES for [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate is CS(=O)(=O)ON=C1C=C(Cl)C(=C(C#N)c2ccccc2)C=C1Cl.
What is the InChIKey of [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate?
The InChIKey is WXKXSVZTDJDLSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2N2O3S/c1-23(20,21)22-19-15-8-13(16)11(7-14(15)17)12(9-18)10-5-3-2-4-6-10/h2-8H,1H3.
What are the key properties of [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate?
[[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate has a molecular weight of 369.23 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[2,5-dichloro-4-[cyano(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]amino] methanesulfonate is sourced from PubChem (CID 54454802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).