C14H15F3O6S — CID 54454883
ethyl 3-[5-(trifluoromethylsulfonyloxy)-2,3-dihydro-1-benzofuran-2-yl]propanoate (PubChem CID 54454883) has the molecular formula C14H15F3O6S and a molecular weight of 368.33 g/mol. Its IUPAC name is ethyl 3-[5-(trifluoromethylsulfonyloxy)-2,3-dihydro-1-benzofuran-2-yl]propanoate.
| Compound Name | ethyl 3-[5-(trifluoromethylsulfonyloxy)-2,3-dihydro-1-benzofuran-2-yl]propanoate |
|---|---|
| PubChem CID | 54454883 |
| Molecular Formula | C14H15F3O6S |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | ethyl 3-[5-(trifluoromethylsulfonyloxy)-2,3-dihydro-1-benzofuran-2-yl]propanoate |
| SMILES | CCOC(=O)CCC1Cc2cc(OS(=O)(=O)C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C14H15F3O6S/c1-2-21-13(18)6-4-10-7-9-8-11(3-5-12(9)22-10)23-24(19,20)14(15,16)17/h3,5,8,10H,2,4,6-7H2,1H3 |
| InChIKey | WXMRDKKNHDPLHP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|