C25H26O5 — CID 54454949
1,5-bis[4-(2-ethenoxyethoxy)phenyl]penta-1,4-dien-3-one (PubChem CID 54454949) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is 1,5-bis[4-(2-ethenoxyethoxy)phenyl]penta-1,4-dien-3-one.
| Compound Name | 1,5-bis[4-(2-ethenoxyethoxy)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 54454949 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1,5-bis[4-(2-ethenoxyethoxy)phenyl]penta-1,4-dien-3-one |
| SMILES | C=COCCOc1ccc(C=CC(=O)C=Cc2ccc(OCCOC=C)cc2)cc1 |
| InChI | InChI=1S/C25H26O5/c1-3-27-17-19-29-24-13-7-21(8-14-24)5-11-23(26)12-6-22-9-15-25(16-10-22)30-20-18-28-4-2/h3-16H,1-2,17-20H2 |
| InChIKey | WXNYRNCJJHUAGZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|