About 1,2-dimethoxycyclobutane
1,2-dimethoxycyclobutane (PubChem CID 54455096) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 1,2-dimethoxycyclobutane.
Molecular Properties
| Compound Name | 1,2-dimethoxycyclobutane |
| PubChem CID | 54455096 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 1,2-dimethoxycyclobutane |
| SMILES | COC1CCC1OC |
| InChI | InChI=1S/C6H12O2/c1-7-5-3-4-6(5)8-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | WXQSINWZOHEUHN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethoxycyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethoxycyclobutane?
The IUPAC name of 1,2-dimethoxycyclobutane (CID 54455096) is 1,2-dimethoxycyclobutane.
What is the SMILES notation for 1,2-dimethoxycyclobutane?
The canonical SMILES for 1,2-dimethoxycyclobutane is COC1CCC1OC.
What is the InChIKey of 1,2-dimethoxycyclobutane?
The InChIKey is WXQSINWZOHEUHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-7-5-3-4-6(5)8-2/h5-6H,3-4H2,1-2H3.
What are the key properties of 1,2-dimethoxycyclobutane?
1,2-dimethoxycyclobutane has a molecular weight of 116.16 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethoxycyclobutane is sourced from PubChem (CID 54455096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).