About 3-diazo-4H-naphthalene-2,7-disulfonic acid
3-diazo-4H-naphthalene-2,7-disulfonic acid (PubChem CID 54455376) has the molecular formula C10H8N2O6S2
and a molecular weight of 316.32 g/mol. Its IUPAC name is 3-diazo-4H-naphthalene-2,7-disulfonic acid.
Molecular Properties
| Compound Name | 3-diazo-4H-naphthalene-2,7-disulfonic acid |
| PubChem CID | 54455376 |
| Molecular Formula | C10H8N2O6S2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 3-diazo-4H-naphthalene-2,7-disulfonic acid |
| SMILES | [N-]=[N+]=C1Cc2ccc(S(=O)(=O)O)cc2C=C1S(=O)(=O)O |
| InChI | InChI=1S/C10H8N2O6S2/c11-12-9-4-6-1-2-8(19(13,14)15)3-7(6)5-10(9)20(16,17)18/h1-3,5H,4H2,(H,13,14,15)(H,16,17,18) |
| InChIKey | WXVMURLYMKAOSU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 145.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-diazo-4H-naphthalene-2,7-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazo-4H-naphthalene-2,7-disulfonic acid?
The IUPAC name of 3-diazo-4H-naphthalene-2,7-disulfonic acid (CID 54455376) is 3-diazo-4H-naphthalene-2,7-disulfonic acid.
What is the SMILES notation for 3-diazo-4H-naphthalene-2,7-disulfonic acid?
The canonical SMILES for 3-diazo-4H-naphthalene-2,7-disulfonic acid is [N-]=[N+]=C1Cc2ccc(S(=O)(=O)O)cc2C=C1S(=O)(=O)O.
What is the InChIKey of 3-diazo-4H-naphthalene-2,7-disulfonic acid?
The InChIKey is WXVMURLYMKAOSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O6S2/c11-12-9-4-6-1-2-8(19(13,14)15)3-7(6)5-10(9)20(16,17)18/h1-3,5H,4H2,(H,13,14,15)(H,16,17,18).
What are the key properties of 3-diazo-4H-naphthalene-2,7-disulfonic acid?
3-diazo-4H-naphthalene-2,7-disulfonic acid has a molecular weight of 316.32 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazo-4H-naphthalene-2,7-disulfonic acid is sourced from PubChem (CID 54455376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).