C11H21ClN2O5 — CID 54455417
3-(2-chloroethyl)-1-propyl-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]urea (PubChem CID 54455417) has the molecular formula C11H21ClN2O5 and a molecular weight of 296.75 g/mol. Its IUPAC name is 3-(2-chloroethyl)-1-propyl-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]urea.
| Compound Name | 3-(2-chloroethyl)-1-propyl-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]urea |
|---|---|
| PubChem CID | 54455417 |
| Molecular Formula | C11H21ClN2O5 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-(2-chloroethyl)-1-propyl-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]urea |
| SMILES | CCCN(C(=O)NCCCl)C1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21ClN2O5/c1-2-5-14(11(18)13-4-3-12)10-9(17)8(16)7(15)6-19-10/h7-10,15-17H,2-6H2,1H3,(H,13,18)/t7-,8+,9-,10?/m1/s1 |
| InChIKey | WXWDSOYOHXTMHZ-WSSOQDAQSA-N |
| XLogP | -0.91 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|