C22H25N5O5 — CID 54455470
6-oxo-6-[3-[2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)ethenyl]anilino]hexanoic acid (PubChem CID 54455470) has the molecular formula C22H25N5O5 and a molecular weight of 439.47 g/mol. Its IUPAC name is 6-oxo-6-[3-[2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)ethenyl]anilino]hexanoic acid.
| Compound Name | 6-oxo-6-[3-[2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)ethenyl]anilino]hexanoic acid |
|---|---|
| PubChem CID | 54455470 |
| Molecular Formula | C22H25N5O5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 6-oxo-6-[3-[2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)ethenyl]anilino]hexanoic acid |
| SMILES | Cn1c(=O)c2c(nc(C=Cc3cccc(NC(=O)CCCCC(=O)O)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C22H25N5O5/c1-25-16(24-20-19(25)21(31)27(3)22(32)26(20)2)12-11-14-7-6-8-15(13-14)23-17(28)9-4-5-10-18(29)30/h6-8,11-13H,4-5,9-10H2,1-3H3,(H,23,28)(H,29,30) |
| InChIKey | WXWZEQBQYRYTDC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|