C15H10ClN5O3S — CID 5445635
5-(5-chlorothiophen-2-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide (PubChem CID 5445635) has the molecular formula C15H10ClN5O3S and a molecular weight of 375.80 g/mol. Its IUPAC name is 5-(5-chlorothiophen-2-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(5-chlorothiophen-2-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5445635 |
| Molecular Formula | C15H10ClN5O3S |
| Molecular Weight | 375.80 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 5-(5-chlorothiophen-2-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(N/N=C\c1ccc([N+](=O)[O-])cc1)c1cc(-c2ccc(Cl)s2)[nH]n1 |
| InChI | InChI=1S/C15H10ClN5O3S/c16-14-6-5-13(25-14)11-7-12(19-18-11)15(22)20-17-8-9-1-3-10(4-2-9)21(23)24/h1-8H,(H,18,19)(H,20,22)/b17-8- |
| InChIKey | TYOUIZULTMBBEM-IUXPMGMMSA-N |
| XLogP | 3.46 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.80 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|