C16H7FO3 — CID 54456647
4-fluoro-11-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione (PubChem CID 54456647) has the molecular formula C16H7FO3 and a molecular weight of 266.23 g/mol. Its IUPAC name is 4-fluoro-11-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione.
| Compound Name | 4-fluoro-11-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione |
|---|---|
| PubChem CID | 54456647 |
| Molecular Formula | C16H7FO3 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 4-fluoro-11-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione |
| SMILES | O=C1OC(=O)c2cc3ccc(F)cc3c3cccc1c23 |
| InChI | InChI=1S/C16H7FO3/c17-9-5-4-8-6-13-14-10(12(8)7-9)2-1-3-11(14)15(18)20-16(13)19/h1-7H |
| InChIKey | WYQQYQKWHHGIGR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|