C6H9NO2S — CID 54456708
1-methyl-3-methylsulfanylpyrrole-2,5-diol (PubChem CID 54456708) has the molecular formula C6H9NO2S and a molecular weight of 159.21 g/mol. Its IUPAC name is 1-methyl-3-methylsulfanylpyrrole-2,5-diol.
| Compound Name | 1-methyl-3-methylsulfanylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 54456708 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 1-methyl-3-methylsulfanylpyrrole-2,5-diol |
| SMILES | CSc1cc(O)n(C)c1O |
| InChI | InChI=1S/C6H9NO2S/c1-7-5(8)3-4(10-2)6(7)9/h3,8-9H,1-2H3 |
| InChIKey | WYRUCGVTJYXDJQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |