C8H7F7O4 — CID 54456817
4-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)-1,3-dioxolan-2-one (PubChem CID 54456817) has the molecular formula C8H7F7O4 and a molecular weight of 300.13 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 54456817 |
| Molecular Formula | C8H7F7O4 |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(COCC(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C8H7F7O4/c9-6(10,7(11,12)8(13,14)15)3-17-1-4-2-18-5(16)19-4/h4H,1-3H2 |
| InChIKey | WYTSCNURXYPSNP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|