C23H19F4N3O4S — CID 54456927
2-[(4-methoxy-3-phenylmethoxy-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole (PubChem CID 54456927) has the molecular formula C23H19F4N3O4S and a molecular weight of 509.48 g/mol. Its IUPAC name is 2-[(4-methoxy-3-phenylmethoxy-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole.
| Compound Name | 2-[(4-methoxy-3-phenylmethoxy-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |
|---|---|
| PubChem CID | 54456927 |
| Molecular Formula | C23H19F4N3O4S |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 2-[(4-methoxy-3-phenylmethoxy-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |
| SMILES | COc1ccnc(CS(=O)c2nc3ccc(OC(F)(F)C(F)F)cc3[nH]2)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H19F4N3O4S/c1-32-19-9-10-28-18(20(19)33-12-14-5-3-2-4-6-14)13-35(31)22-29-16-8-7-15(11-17(16)30-22)34-23(26,27)21(24)25/h2-11,21H,12-13H2,1H3,(H,29,30) |
| InChIKey | WYVQUSHBPKPCRE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|