C14H11BrN4O2S — CID 5445717
5-(5-bromothiophen-2-yl)-N-[(Z)-1-(furan-2-yl)ethylideneamino]-1H-pyrazole-3-carboxamide (PubChem CID 5445717) has the molecular formula C14H11BrN4O2S and a molecular weight of 379.24 g/mol. Its IUPAC name is 5-(5-bromothiophen-2-yl)-N-[(Z)-1-(furan-2-yl)ethylideneamino]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(5-bromothiophen-2-yl)-N-[(Z)-1-(furan-2-yl)ethylideneamino]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5445717 |
| Molecular Formula | C14H11BrN4O2S |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 5-(5-bromothiophen-2-yl)-N-[(Z)-1-(furan-2-yl)ethylideneamino]-1H-pyrazole-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(-c2ccc(Br)s2)[nH]n1)c1ccco1 |
| InChI | InChI=1S/C14H11BrN4O2S/c1-8(11-3-2-6-21-11)16-19-14(20)10-7-9(17-18-10)12-4-5-13(15)22-12/h2-7H,1H3,(H,17,18)(H,19,20)/b16-8- |
| InChIKey | HLNBXZMBXXJDFE-PXNMLYILSA-N |
| XLogP | 3.65 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|