C13H19NO4 — CID 54458524
pentyl 3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylate (PubChem CID 54458524) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is pentyl 3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylate.
| Compound Name | pentyl 3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylate |
|---|---|
| PubChem CID | 54458524 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | pentyl 3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylate |
| SMILES | CCCCCOC(=O)C1CC2CCC(=O)N2C1=O |
| InChI | InChI=1S/C13H19NO4/c1-2-3-4-7-18-13(17)10-8-9-5-6-11(15)14(9)12(10)16/h9-10H,2-8H2,1H3 |
| InChIKey | WZXSQAFUQJQUAD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|