C22H21N5O — CID 54458995
N-[4-(3,4,5,6-tetrahydro-2H-1-benzazocin-1-yl)pyrido[3,4-d]pyrimidin-2-yl]buta-2,3-dienamide (PubChem CID 54458995) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[4-(3,4,5,6-tetrahydro-2H-1-benzazocin-1-yl)pyrido[3,4-d]pyrimidin-2-yl]buta-2,3-dienamide.
| Compound Name | N-[4-(3,4,5,6-tetrahydro-2H-1-benzazocin-1-yl)pyrido[3,4-d]pyrimidin-2-yl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 54458995 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[4-(3,4,5,6-tetrahydro-2H-1-benzazocin-1-yl)pyrido[3,4-d]pyrimidin-2-yl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)Nc1nc(N2CCCCCc3ccccc32)c2ccncc2n1 |
| InChI | InChI=1S/C22H21N5O/c1-2-8-20(28)25-22-24-18-15-23-13-12-17(18)21(26-22)27-14-7-3-4-9-16-10-5-6-11-19(16)27/h5-6,8,10-13,15H,1,3-4,7,9,14H2,(H,24,25,26,28) |
| InChIKey | XAGSCXSQZZYCLU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|