About 4-fluoro-1,2-benzothiazole
4-fluoro-1,2-benzothiazole (PubChem CID 54459201) has the molecular formula C7H4FNS
and a molecular weight of 153.18 g/mol. Its IUPAC name is 4-fluoro-1,2-benzothiazole.
Molecular Properties
| Compound Name | 4-fluoro-1,2-benzothiazole |
| PubChem CID | 54459201 |
| Molecular Formula | C7H4FNS |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.00 |
| IUPAC Name | 4-fluoro-1,2-benzothiazole |
| SMILES | Fc1cccc2sncc12 |
| InChI | InChI=1S/C7H4FNS/c8-6-2-1-3-7-5(6)4-9-10-7/h1-4H |
| InChIKey | QNKJNSZZYKGSKK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,2-benzothiazole?
The IUPAC name of 4-fluoro-1,2-benzothiazole (CID 54459201) is 4-fluoro-1,2-benzothiazole.
What is the SMILES notation for 4-fluoro-1,2-benzothiazole?
The canonical SMILES for 4-fluoro-1,2-benzothiazole is Fc1cccc2sncc12.
What is the InChIKey of 4-fluoro-1,2-benzothiazole?
The InChIKey is QNKJNSZZYKGSKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNS/c8-6-2-1-3-7-5(6)4-9-10-7/h1-4H.
What are the key properties of 4-fluoro-1,2-benzothiazole?
4-fluoro-1,2-benzothiazole has a molecular weight of 153.18 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,2-benzothiazole is sourced from PubChem (CID 54459201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).