About 6-iminooctan-1-ol
6-iminooctan-1-ol (PubChem CID 54459280) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 6-iminooctan-1-ol.
Molecular Properties
| Compound Name | 6-iminooctan-1-ol |
| PubChem CID | 54459280 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 6-iminooctan-1-ol |
| SMILES | [H]/N=C(\CC)CCCCCO |
| InChI | InChI=1S/C8H17NO/c1-2-8(9)6-4-3-5-7-10/h9-10H,2-7H2,1H3/b9-8+ |
| InChIKey | XALPCVJNDDSLFD-CMDGGOBGSA-N |
| XLogP | 1.97 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-iminooctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iminooctan-1-ol?
The IUPAC name of 6-iminooctan-1-ol (CID 54459280) is 6-iminooctan-1-ol.
What is the SMILES notation for 6-iminooctan-1-ol?
The canonical SMILES for 6-iminooctan-1-ol is [H]/N=C(\CC)CCCCCO.
What is the InChIKey of 6-iminooctan-1-ol?
The InChIKey is XALPCVJNDDSLFD-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H17NO/c1-2-8(9)6-4-3-5-7-10/h9-10H,2-7H2,1H3/b9-8+.
What are the key properties of 6-iminooctan-1-ol?
6-iminooctan-1-ol has a molecular weight of 143.23 g/mol, XLogP of 1.97, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iminooctan-1-ol is sourced from PubChem (CID 54459280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).