C23H22F3NO3S — CID 54459566
2-[4-[5-(trifluoromethylsulfonyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidin-1-yl]ethanol (PubChem CID 54459566) has the molecular formula C23H22F3NO3S and a molecular weight of 449.49 g/mol. Its IUPAC name is 2-[4-[5-(trifluoromethylsulfonyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[5-(trifluoromethylsulfonyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 54459566 |
| Molecular Formula | C23H22F3NO3S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2-[4-[5-(trifluoromethylsulfonyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidin-1-yl]ethanol |
| SMILES | O=S(=O)(c1ccc2c(c1)C(=C1CCN(CCO)CC1)c1ccccc1C=C2)C(F)(F)F |
| InChI | InChI=1S/C23H22F3NO3S/c24-23(25,26)31(29,30)19-8-7-17-6-5-16-3-1-2-4-20(16)22(21(17)15-19)18-9-11-27(12-10-18)13-14-28/h1-8,15,28H,9-14H2 |
| InChIKey | XAQZTJRMCLGUSM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|