About 2-(3,7-dimethylocta-2,6-dienylamino)ethanol
2-(3,7-dimethylocta-2,6-dienylamino)ethanol (PubChem CID 54460066) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienylamino)ethanol.
Molecular Properties
| Compound Name | 2-(3,7-dimethylocta-2,6-dienylamino)ethanol |
| PubChem CID | 54460066 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienylamino)ethanol |
| SMILES | CC(C)=CCCC(C)=CCNCCO |
| InChI | InChI=1S/C12H23NO/c1-11(2)5-4-6-12(3)7-8-13-9-10-14/h5,7,13-14H,4,6,8-10H2,1-3H3 |
| InChIKey | XAZPMBFSZCPDSR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,7-dimethylocta-2,6-dienylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,7-dimethylocta-2,6-dienylamino)ethanol?
The IUPAC name of 2-(3,7-dimethylocta-2,6-dienylamino)ethanol (CID 54460066) is 2-(3,7-dimethylocta-2,6-dienylamino)ethanol.
What is the SMILES notation for 2-(3,7-dimethylocta-2,6-dienylamino)ethanol?
The canonical SMILES for 2-(3,7-dimethylocta-2,6-dienylamino)ethanol is CC(C)=CCCC(C)=CCNCCO.
What is the InChIKey of 2-(3,7-dimethylocta-2,6-dienylamino)ethanol?
The InChIKey is XAZPMBFSZCPDSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-11(2)5-4-6-12(3)7-8-13-9-10-14/h5,7,13-14H,4,6,8-10H2,1-3H3.
What are the key properties of 2-(3,7-dimethylocta-2,6-dienylamino)ethanol?
2-(3,7-dimethylocta-2,6-dienylamino)ethanol has a molecular weight of 197.32 g/mol, XLogP of 2.26, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,7-dimethylocta-2,6-dienylamino)ethanol is sourced from PubChem (CID 54460066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).