C14H16N4O2 — CID 54460368
3-methyl-4-[3-methyl-5-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)penta-2,4-dienylidene]-1H-pyrazol-5-one (PubChem CID 54460368) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-methyl-4-[3-methyl-5-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)penta-2,4-dienylidene]-1H-pyrazol-5-one.
| Compound Name | 3-methyl-4-[3-methyl-5-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)penta-2,4-dienylidene]-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 54460368 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-methyl-4-[3-methyl-5-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)penta-2,4-dienylidene]-1H-pyrazol-5-one |
| SMILES | CC(C=Cc1c(C)[nH][nH]c1=O)=CC=C1C(=O)NN=C1C |
| InChI | InChI=1S/C14H16N4O2/c1-8(4-6-11-9(2)15-17-13(11)19)5-7-12-10(3)16-18-14(12)20/h4-7H,1-3H3,(H,17,19)(H2,16,18,20) |
| InChIKey | MMZHPHQEOULJPJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|