C8H18O5Si — CID 54461247
(2R,4R)-1,2,4,5-tetrahydroxy-1-trimethylsilylpentan-3-one (PubChem CID 54461247) has the molecular formula C8H18O5Si and a molecular weight of 222.31 g/mol. Its IUPAC name is (2R,4R)-1,2,4,5-tetrahydroxy-1-trimethylsilylpentan-3-one.
| Compound Name | (2R,4R)-1,2,4,5-tetrahydroxy-1-trimethylsilylpentan-3-one |
|---|---|
| PubChem CID | 54461247 |
| Molecular Formula | C8H18O5Si |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2R,4R)-1,2,4,5-tetrahydroxy-1-trimethylsilylpentan-3-one |
| SMILES | C[Si](C)(C)C(O)[C@H](O)C(=O)[C@H](O)CO |
| InChI | InChI=1S/C8H18O5Si/c1-14(2,3)8(13)7(12)6(11)5(10)4-9/h5,7-10,12-13H,4H2,1-3H3/t5-,7-,8?/m1/s1 |
| InChIKey | XBTZETJJGGNBFF-ULFNDUEJSA-N |
| XLogP | -1.49 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|