C20H32N2O3 — CID 54461377
7-[6-(3-hydroxyoct-1-enyl)-2,3-diazabicyclo[2.2.1]hept-2-en-5-yl]hept-5-enoic acid (PubChem CID 54461377) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 7-[6-(3-hydroxyoct-1-enyl)-2,3-diazabicyclo[2.2.1]hept-2-en-5-yl]hept-5-enoic acid.
| Compound Name | 7-[6-(3-hydroxyoct-1-enyl)-2,3-diazabicyclo[2.2.1]hept-2-en-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54461377 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 7-[6-(3-hydroxyoct-1-enyl)-2,3-diazabicyclo[2.2.1]hept-2-en-5-yl]hept-5-enoic acid |
| SMILES | CCCCCC(O)C=CC1C2CC(N=N2)C1CC=CCCCC(=O)O |
| InChI | InChI=1S/C20H32N2O3/c1-2-3-6-9-15(23)12-13-17-16(18-14-19(17)22-21-18)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25) |
| InChIKey | XBVVXCYNLAIXKD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|