About 3-bromo-N,N-diethylthiophene-2-carboxamide
3-bromo-N,N-diethylthiophene-2-carboxamide (PubChem CID 54461600) has the molecular formula C9H12BrNOS
and a molecular weight of 262.17 g/mol. Its IUPAC name is 3-bromo-N,N-diethylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-bromo-N,N-diethylthiophene-2-carboxamide |
| PubChem CID | 54461600 |
| Molecular Formula | C9H12BrNOS |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 3-bromo-N,N-diethylthiophene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1sccc1Br |
| InChI | InChI=1S/C9H12BrNOS/c1-3-11(4-2)9(12)8-7(10)5-6-13-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | XBZILZVDTTWYLG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-N,N-diethylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N,N-diethylthiophene-2-carboxamide?
The IUPAC name of 3-bromo-N,N-diethylthiophene-2-carboxamide (CID 54461600) is 3-bromo-N,N-diethylthiophene-2-carboxamide.
What is the SMILES notation for 3-bromo-N,N-diethylthiophene-2-carboxamide?
The canonical SMILES for 3-bromo-N,N-diethylthiophene-2-carboxamide is CCN(CC)C(=O)c1sccc1Br.
What is the InChIKey of 3-bromo-N,N-diethylthiophene-2-carboxamide?
The InChIKey is XBZILZVDTTWYLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNOS/c1-3-11(4-2)9(12)8-7(10)5-6-13-8/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-bromo-N,N-diethylthiophene-2-carboxamide?
3-bromo-N,N-diethylthiophene-2-carboxamide has a molecular weight of 262.17 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N,N-diethylthiophene-2-carboxamide is sourced from PubChem (CID 54461600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).