C13H12FNO — CID 54462271
8-fluoro-4,4a,5,6-tetrahydro-2H-benzo[h]quinolin-3-one (PubChem CID 54462271) has the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. Its IUPAC name is 8-fluoro-4,4a,5,6-tetrahydro-2H-benzo[h]quinolin-3-one.
| Compound Name | 8-fluoro-4,4a,5,6-tetrahydro-2H-benzo[h]quinolin-3-one |
|---|---|
| PubChem CID | 54462271 |
| Molecular Formula | C13H12FNO |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 8-fluoro-4,4a,5,6-tetrahydro-2H-benzo[h]quinolin-3-one |
| SMILES | O=C1CN=C2c3ccc(F)cc3CCC2C1 |
| InChI | InChI=1S/C13H12FNO/c14-10-3-4-12-8(5-10)1-2-9-6-11(16)7-15-13(9)12/h3-5,9H,1-2,6-7H2 |
| InChIKey | XCKVGMJKXPQYFR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |