C20H12F4N2O6 — CID 54462464
2-amino-5-[4-(4-amino-3-carboxyphenoxy)-2,3,5,6-tetrafluorophenoxy]benzoic acid (PubChem CID 54462464) has the molecular formula C20H12F4N2O6 and a molecular weight of 452.32 g/mol. Its IUPAC name is 2-amino-5-[4-(4-amino-3-carboxyphenoxy)-2,3,5,6-tetrafluorophenoxy]benzoic acid.
| Compound Name | 2-amino-5-[4-(4-amino-3-carboxyphenoxy)-2,3,5,6-tetrafluorophenoxy]benzoic acid |
|---|---|
| PubChem CID | 54462464 |
| Molecular Formula | C20H12F4N2O6 |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2-amino-5-[4-(4-amino-3-carboxyphenoxy)-2,3,5,6-tetrafluorophenoxy]benzoic acid |
| SMILES | Nc1ccc(Oc2c(F)c(F)c(Oc3ccc(N)c(C(=O)O)c3)c(F)c2F)cc1C(=O)O |
| InChI | InChI=1S/C20H12F4N2O6/c21-13-15(23)18(32-8-2-4-12(26)10(6-8)20(29)30)16(24)14(22)17(13)31-7-1-3-11(25)9(5-7)19(27)28/h1-6H,25-26H2,(H,27,28)(H,29,30) |
| InChIKey | XCNZEPRSYVQSQE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|