About [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate
[(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 5446268) has the molecular formula C18H14ClN3O3
and a molecular weight of 355.78 g/mol. Its IUPAC name is [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| PubChem CID | 5446268 |
| Molecular Formula | C18H14ClN3O3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | C/C(=N\OC(=O)c1c(-c2ccccc2Cl)noc1C)c1ccncc1 |
| InChI | InChI=1S/C18H14ClN3O3/c1-11(13-7-9-20-10-8-13)21-25-18(23)16-12(2)24-22-17(16)14-5-3-4-6-15(14)19/h3-10H,1-2H3/b21-11+ |
| InChIKey | DYXGYUKHSBMBCB-SRZZPIQSSA-N |
| XLogP | 4.28 |
| TPSA | 77.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate?
The IUPAC name of [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (CID 5446268) is [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate is C/C(=N\OC(=O)c1c(-c2ccccc2Cl)noc1C)c1ccncc1.
What is the InChIKey of [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate?
The InChIKey is DYXGYUKHSBMBCB-SRZZPIQSSA-N. The full InChI is InChI=1S/C18H14ClN3O3/c1-11(13-7-9-20-10-8-13)21-25-18(23)16-12(2)24-22-17(16)14-5-3-4-6-15(14)19/h3-10H,1-2H3/b21-11+.
What are the key properties of [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate?
[(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate has a molecular weight of 355.78 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-pyridin-4-ylethylideneamino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 5446268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).