About ethyl 3-benzylimino-2,4-difluorobutanoate
ethyl 3-benzylimino-2,4-difluorobutanoate (PubChem CID 54462749) has the molecular formula C13H15F2NO2
and a molecular weight of 255.26 g/mol. Its IUPAC name is ethyl 3-benzylimino-2,4-difluorobutanoate.
Molecular Properties
| Compound Name | ethyl 3-benzylimino-2,4-difluorobutanoate |
| PubChem CID | 54462749 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | ethyl 3-benzylimino-2,4-difluorobutanoate |
| SMILES | CCOC(=O)C(F)/C(CF)=N/Cc1ccccc1 |
| InChI | InChI=1S/C13H15F2NO2/c1-2-18-13(17)12(15)11(8-14)16-9-10-6-4-3-5-7-10/h3-7,12H,2,8-9H2,1H3/b16-11+ |
| InChIKey | XCSWIOJETSTFSG-LFIBNONCSA-N |
| XLogP | 2.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-benzylimino-2,4-difluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-benzylimino-2,4-difluorobutanoate?
The IUPAC name of ethyl 3-benzylimino-2,4-difluorobutanoate (CID 54462749) is ethyl 3-benzylimino-2,4-difluorobutanoate.
What is the SMILES notation for ethyl 3-benzylimino-2,4-difluorobutanoate?
The canonical SMILES for ethyl 3-benzylimino-2,4-difluorobutanoate is CCOC(=O)C(F)/C(CF)=N/Cc1ccccc1.
What is the InChIKey of ethyl 3-benzylimino-2,4-difluorobutanoate?
The InChIKey is XCSWIOJETSTFSG-LFIBNONCSA-N. The full InChI is InChI=1S/C13H15F2NO2/c1-2-18-13(17)12(15)11(8-14)16-9-10-6-4-3-5-7-10/h3-7,12H,2,8-9H2,1H3/b16-11+.
What are the key properties of ethyl 3-benzylimino-2,4-difluorobutanoate?
ethyl 3-benzylimino-2,4-difluorobutanoate has a molecular weight of 255.26 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-benzylimino-2,4-difluorobutanoate is sourced from PubChem (CID 54462749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).