About 2-(dihexylamino)ethyl prop-2-enoate
2-(dihexylamino)ethyl prop-2-enoate (PubChem CID 54463333) has the molecular formula C17H33NO2
and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-(dihexylamino)ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-(dihexylamino)ethyl prop-2-enoate |
| PubChem CID | 54463333 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 2-(dihexylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(CCCCCC)CCCCCC |
| InChI | InChI=1S/C17H33NO2/c1-4-7-9-11-13-18(14-12-10-8-5-2)15-16-20-17(19)6-3/h6H,3-5,7-16H2,1-2H3 |
| InChIKey | XDDIBAVYVYCQBC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dihexylamino)ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dihexylamino)ethyl prop-2-enoate?
The IUPAC name of 2-(dihexylamino)ethyl prop-2-enoate (CID 54463333) is 2-(dihexylamino)ethyl prop-2-enoate.
What is the SMILES notation for 2-(dihexylamino)ethyl prop-2-enoate?
The canonical SMILES for 2-(dihexylamino)ethyl prop-2-enoate is C=CC(=O)OCCN(CCCCCC)CCCCCC.
What is the InChIKey of 2-(dihexylamino)ethyl prop-2-enoate?
The InChIKey is XDDIBAVYVYCQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO2/c1-4-7-9-11-13-18(14-12-10-8-5-2)15-16-20-17(19)6-3/h6H,3-5,7-16H2,1-2H3.
What are the key properties of 2-(dihexylamino)ethyl prop-2-enoate?
2-(dihexylamino)ethyl prop-2-enoate has a molecular weight of 283.46 g/mol, XLogP of 4.18, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dihexylamino)ethyl prop-2-enoate is sourced from PubChem (CID 54463333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).