About 2,4-diaminopentanal
2,4-diaminopentanal (PubChem CID 54463377) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is 2,4-diaminopentanal.
Molecular Properties
| Compound Name | 2,4-diaminopentanal |
| PubChem CID | 54463377 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | 2,4-diaminopentanal |
| SMILES | CC(N)CC(N)C=O |
| InChI | InChI=1S/C5H12N2O/c1-4(6)2-5(7)3-8/h3-5H,2,6-7H2,1H3 |
| InChIKey | MJQQPCMTJVTFKR-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diaminopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diaminopentanal?
The IUPAC name of 2,4-diaminopentanal (CID 54463377) is 2,4-diaminopentanal.
What is the SMILES notation for 2,4-diaminopentanal?
The canonical SMILES for 2,4-diaminopentanal is CC(N)CC(N)C=O.
What is the InChIKey of 2,4-diaminopentanal?
The InChIKey is MJQQPCMTJVTFKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-4(6)2-5(7)3-8/h3-5H,2,6-7H2,1H3.
What are the key properties of 2,4-diaminopentanal?
2,4-diaminopentanal has a molecular weight of 116.16 g/mol, XLogP of -0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diaminopentanal is sourced from PubChem (CID 54463377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).