About [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate
[2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate (PubChem CID 54463769) has the molecular formula C15H23F2NO5S2
and a molecular weight of 399.48 g/mol. Its IUPAC name is [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate.
Molecular Properties
| Compound Name | [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate |
| PubChem CID | 54463769 |
| Molecular Formula | C15H23F2NO5S2 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)CCCNCCC(F)(F)COS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23F2NO5S2/c1-13-4-6-14(7-5-13)25(21,22)11-3-9-18-10-8-15(16,17)12-23-24(2,19)20/h4-7,18H,3,8-12H2,1-2H3 |
| InChIKey | XDKWQDICIQVANU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate?
The IUPAC name of [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate (CID 54463769) is [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate.
What is the SMILES notation for [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate?
The canonical SMILES for [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate is Cc1ccc(S(=O)(=O)CCCNCCC(F)(F)COS(C)(=O)=O)cc1.
What is the InChIKey of [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate?
The InChIKey is XDKWQDICIQVANU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F2NO5S2/c1-13-4-6-14(7-5-13)25(21,22)11-3-9-18-10-8-15(16,17)12-23-24(2,19)20/h4-7,18H,3,8-12H2,1-2H3.
What are the key properties of [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate?
[2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate has a molecular weight of 399.48 g/mol, XLogP of 1.75, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-4-[3-(4-methylphenyl)sulfonylpropylamino]butyl] methanesulfonate is sourced from PubChem (CID 54463769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).