About 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione
5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione (PubChem CID 54463947) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione.
Molecular Properties
| Compound Name | 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione |
| PubChem CID | 54463947 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione |
| SMILES | CC[C@H](C)n1cnc(=S)nc1 |
| InChI | InChI=1S/C7H11N3S/c1-3-6(2)10-4-8-7(11)9-5-10/h4-6H,3H2,1-2H3/t6-/m0/s1 |
| InChIKey | XDOFEXYZMNCVOW-LURJTMIESA-N |
| XLogP | 1.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione?
The IUPAC name of 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione (CID 54463947) is 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione.
What is the SMILES notation for 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione?
The canonical SMILES for 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione is CC[C@H](C)n1cnc(=S)nc1.
What is the InChIKey of 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione?
The InChIKey is XDOFEXYZMNCVOW-LURJTMIESA-N. The full InChI is InChI=1S/C7H11N3S/c1-3-6(2)10-4-8-7(11)9-5-10/h4-6H,3H2,1-2H3/t6-/m0/s1.
What are the key properties of 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione?
5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione has a molecular weight of 169.25 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S)-butan-2-yl]-1,3,5-triazine-2-thione is sourced from PubChem (CID 54463947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).