C23H30O4 — CID 54463958
4-[[(2R,3S,4S)-3-(3-cyclohexyl-3-hydroxyprop-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]benzoic acid (PubChem CID 54463958) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 4-[[(2R,3S,4S)-3-(3-cyclohexyl-3-hydroxyprop-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[(2R,3S,4S)-3-(3-cyclohexyl-3-hydroxyprop-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 54463958 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 4-[[(2R,3S,4S)-3-(3-cyclohexyl-3-hydroxyprop-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C[C@H]2C3CC[C@H](O3)[C@H]2C=CC(O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H30O4/c24-20(16-4-2-1-3-5-16)11-10-18-19(22-13-12-21(18)27-22)14-15-6-8-17(9-7-15)23(25)26/h6-11,16,18-22,24H,1-5,12-14H2,(H,25,26)/t18-,19+,20?,21-,22?/m0/s1 |
| InChIKey | XDOIMRIDQKWAEF-HKHIRDCPSA-N |
| XLogP | 4.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|