C36H68F6O3Si3 — CID 54464499
[12-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]-1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)dodec-10-en-2-yl]oxy-trimethylsilane (PubChem CID 54464499) has the molecular formula C36H68F6O3Si3 and a molecular weight of 747.18 g/mol. Its IUPAC name is [12-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]-1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)dodec-10-en-2-yl]oxy-trimethylsilane.
| Compound Name | [12-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]-1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)dodec-10-en-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 54464499 |
| Molecular Formula | C36H68F6O3Si3 |
| Molecular Weight | 747.18 g/mol |
| Exact Mass | 746.44 |
| IUPAC Name | [12-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]-1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)dodec-10-en-2-yl]oxy-trimethylsilane |
| SMILES | CC(C)(CCCC=CC=C1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C1)CCCC(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C36H68F6O3Si3/c1-31(2,3)47(12,13)43-29-25-28(26-30(27-29)44-48(14,15)32(4,5)6)21-18-16-17-19-22-33(7,8)23-20-24-34(35(37,38)39,36(40,41)42)45-46(9,10)11/h16,18,21,29-30H,17,19-20,22-27H2,1-15H3/t29-,30-/m1/s1 |
| InChIKey | XDXDUIYHVOHXKV-LOYHVIPDSA-N |
| XLogP | 13.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.18 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|