C17H28Cl2O3Si — CID 54464754
(2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)pentane-1,2-diol (PubChem CID 54464754) has the molecular formula C17H28Cl2O3Si and a molecular weight of 379.40 g/mol. Its IUPAC name is (2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)pentane-1,2-diol.
| Compound Name | (2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 54464754 |
| Molecular Formula | C17H28Cl2O3Si |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)pentane-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@](O)(CO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H28Cl2O3Si/c1-16(2,3)23(4,5)22-10-6-9-17(21,12-20)13-7-8-14(18)15(19)11-13/h7-8,11,20-21H,6,9-10,12H2,1-5H3/t17-/m0/s1 |
| InChIKey | XEBCVLWFLSYNQJ-KRWDZBQOSA-N |
| XLogP | 4.98 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|