C23H25ClN4O7S2 — CID 54465370
4-[5-chloro-2-[3-[2-(1-hydroxyethoxy)ethyl]-5-oxo-1-pyridin-2-yl-2-sulfanylideneimidazolidin-4-ylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonic acid (PubChem CID 54465370) has the molecular formula C23H25ClN4O7S2 and a molecular weight of 569.06 g/mol. Its IUPAC name is 4-[5-chloro-2-[3-[2-(1-hydroxyethoxy)ethyl]-5-oxo-1-pyridin-2-yl-2-sulfanylideneimidazolidin-4-ylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[5-chloro-2-[3-[2-(1-hydroxyethoxy)ethyl]-5-oxo-1-pyridin-2-yl-2-sulfanylideneimidazolidin-4-ylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 54465370 |
| Molecular Formula | C23H25ClN4O7S2 |
| Molecular Weight | 569.06 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | 4-[5-chloro-2-[3-[2-(1-hydroxyethoxy)ethyl]-5-oxo-1-pyridin-2-yl-2-sulfanylideneimidazolidin-4-ylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonic acid |
| SMILES | CC(O)OCCN1C(=S)N(c2ccccn2)C(=O)C1=C1Oc2ccc(Cl)cc2N1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C23H25ClN4O7S2/c1-15(29)34-12-11-27-20(21(30)28(23(27)36)19-6-2-3-9-25-19)22-26(10-4-5-13-37(31,32)33)17-14-16(24)7-8-18(17)35-22/h2-3,6-9,14-15,29H,4-5,10-13H2,1H3,(H,31,32,33) |
| InChIKey | XELNOKNPCOLOPP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.06 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|