C9H12BrFO2 — CID 54465683
cis-(1R,3S)-3-(3-bromo-2-fluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 54465683) has the molecular formula C9H12BrFO2 and a molecular weight of 251.09 g/mol. Its IUPAC name is cis-(1R,3S)-3-(3-bromo-2-fluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(3-bromo-2-fluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 54465683 |
| Molecular Formula | C9H12BrFO2 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | cis-(1R,3S)-3-(3-bromo-2-fluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C=C(F)CBr)[C@H]1C(=O)O |
| InChI | InChI=1S/C9H12BrFO2/c1-9(2)6(3-5(11)4-10)7(9)8(12)13/h3,6-7H,4H2,1-2H3,(H,12,13)/t6-,7+/m1/s1 |
| InChIKey | XERFRNHYRKOTKT-RQJHMYQMSA-N |
| XLogP | 2.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|