C20H28N2O6 — CID 54465829
3-[[4-[methyl(2-phenoxyethyl)amino]-4-oxo-2-propan-2-ylbutanoyl]amino]-4-oxobutanoic acid (PubChem CID 54465829) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is 3-[[4-[methyl(2-phenoxyethyl)amino]-4-oxo-2-propan-2-ylbutanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[4-[methyl(2-phenoxyethyl)amino]-4-oxo-2-propan-2-ylbutanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54465829 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 3-[[4-[methyl(2-phenoxyethyl)amino]-4-oxo-2-propan-2-ylbutanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)C(CC(=O)N(C)CCOc1ccccc1)C(=O)NC(C=O)CC(=O)O |
| InChI | InChI=1S/C20H28N2O6/c1-14(2)17(20(27)21-15(13-23)11-19(25)26)12-18(24)22(3)9-10-28-16-7-5-4-6-8-16/h4-8,13-15,17H,9-12H2,1-3H3,(H,21,27)(H,25,26) |
| InChIKey | XETWXTRPXCSOBF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|