About 2,5-benzodiazocine
2,5-benzodiazocine (PubChem CID 54466007) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2,5-benzodiazocine.
Molecular Properties
| Compound Name | 2,5-benzodiazocine |
| PubChem CID | 54466007 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2,5-benzodiazocine |
| SMILES | C1=c2ccccc2=C/N=C\C=N/1 |
| InChI | InChI=1S/C10H8N2/c1-2-4-10-8-12-6-5-11-7-9(10)3-1/h1-8H/b6-5-,9-7?,10-8?,11-5-,11-7?,12-6-,12-8? |
| InChIKey | XEXGJZPJUQVPBN-ATDLPCCOSA-N |
| XLogP | 0.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-benzodiazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-benzodiazocine?
The IUPAC name of 2,5-benzodiazocine (CID 54466007) is 2,5-benzodiazocine.
What is the SMILES notation for 2,5-benzodiazocine?
The canonical SMILES for 2,5-benzodiazocine is C1=c2ccccc2=C/N=C\C=N/1.
What is the InChIKey of 2,5-benzodiazocine?
The InChIKey is XEXGJZPJUQVPBN-ATDLPCCOSA-N. The full InChI is InChI=1S/C10H8N2/c1-2-4-10-8-12-6-5-11-7-9(10)3-1/h1-8H/b6-5-,9-7?,10-8?,11-5-,11-7?,12-6-,12-8?.
What are the key properties of 2,5-benzodiazocine?
2,5-benzodiazocine has a molecular weight of 156.19 g/mol, XLogP of 0.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-benzodiazocine is sourced from PubChem (CID 54466007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).