C30H50O2 — CID 54466345
2-(3,7-dimethyl-9,9-dipentoxynona-1,3,5,7-tetraenyl)-1,3,3-trimethylcyclohexene (PubChem CID 54466345) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 2-(3,7-dimethyl-9,9-dipentoxynona-1,3,5,7-tetraenyl)-1,3,3-trimethylcyclohexene.
| Compound Name | 2-(3,7-dimethyl-9,9-dipentoxynona-1,3,5,7-tetraenyl)-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 54466345 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | 2-(3,7-dimethyl-9,9-dipentoxynona-1,3,5,7-tetraenyl)-1,3,3-trimethylcyclohexene |
| SMILES | CCCCCOC(C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C)OCCCCC |
| InChI | InChI=1S/C30H50O2/c1-8-10-12-22-31-29(32-23-13-11-9-2)24-26(4)17-14-16-25(3)19-20-28-27(5)18-15-21-30(28,6)7/h14,16-17,19-20,24,29H,8-13,15,18,21-23H2,1-7H3 |
| InChIKey | XFDBUVYNQGIXAR-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|